C16H22O4 — CID 169408928
ethyl (E)-3-[(3aS,7aR)-2-oxo-3a-propyl-4,5-dihydro-3H-1-benzofuran-7a-yl]prop-2-enoate (PubChem CID 169408928) has the molecular formula C16H22O4 and a molecular weight of 278.35 g/mol. Its IUPAC name is ethyl (E)-3-[(3aS,7aR)-2-oxo-3a-propyl-4,5-dihydro-3H-1-benzofuran-7a-yl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[(3aS,7aR)-2-oxo-3a-propyl-4,5-dihydro-3H-1-benzofuran-7a-yl]prop-2-enoate |
|---|---|
| PubChem CID | 169408928 |
| Molecular Formula | C16H22O4 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | ethyl (E)-3-[(3aS,7aR)-2-oxo-3a-propyl-4,5-dihydro-3H-1-benzofuran-7a-yl]prop-2-enoate |
| SMILES | CCC[C@@]12CCC=C[C@]1(/C=C/C(=O)OCC)OC(=O)C2 |
| InChI | InChI=1S/C16H22O4/c1-3-8-15-9-5-6-10-16(15,20-14(18)12-15)11-7-13(17)19-4-2/h6-7,10-11H,3-5,8-9,12H2,1-2H3/b11-7+/t15-,16+/m0/s1 |
| InChIKey | OIHXOJBNDRKQLK-YWUZZIELSA-N |
| XLogP | 2.93 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|