C17H23IO4 — CID 135079476
tert-butyl (E)-5-[(5R,8S)-8-iodo-5-methyl-7-oxo-6-oxabicyclo[3.2.1]oct-2-en-1-yl]pent-2-enoate (PubChem CID 135079476) has the molecular formula C17H23IO4 and a molecular weight of 418.27 g/mol. Its IUPAC name is tert-butyl (E)-5-[(5R,8S)-8-iodo-5-methyl-7-oxo-6-oxabicyclo[3.2.1]oct-2-en-1-yl]pent-2-enoate.
| Compound Name | tert-butyl (E)-5-[(5R,8S)-8-iodo-5-methyl-7-oxo-6-oxabicyclo[3.2.1]oct-2-en-1-yl]pent-2-enoate |
|---|---|
| PubChem CID | 135079476 |
| Molecular Formula | C17H23IO4 |
| Molecular Weight | 418.27 g/mol |
| Exact Mass | 418.06 |
| IUPAC Name | tert-butyl (E)-5-[(5R,8S)-8-iodo-5-methyl-7-oxo-6-oxabicyclo[3.2.1]oct-2-en-1-yl]pent-2-enoate |
| SMILES | CC(C)(C)OC(=O)/C=C/CCC12C=CC[C@@](C)(OC1=O)[C@H]2I |
| InChI | InChI=1S/C17H23IO4/c1-15(2,3)21-12(19)8-5-6-10-17-11-7-9-16(4,13(17)18)22-14(17)20/h5,7-8,11,13H,6,9-10H2,1-4H3/b8-5+/t13-,16-,17?/m1/s1 |
| InChIKey | KZPTUGBXKIBNIY-YYOBUFASSA-N |
| XLogP | 3.73 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.27 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|