C18H26O4 — CID 169408934
butyl (E)-3-[(3aS,7aR)-2-oxo-3a-propyl-4,5-dihydro-3H-1-benzofuran-7a-yl]prop-2-enoate (PubChem CID 169408934) has the molecular formula C18H26O4 and a molecular weight of 306.40 g/mol. Its IUPAC name is butyl (E)-3-[(3aS,7aR)-2-oxo-3a-propyl-4,5-dihydro-3H-1-benzofuran-7a-yl]prop-2-enoate.
| Compound Name | butyl (E)-3-[(3aS,7aR)-2-oxo-3a-propyl-4,5-dihydro-3H-1-benzofuran-7a-yl]prop-2-enoate |
|---|---|
| PubChem CID | 169408934 |
| Molecular Formula | C18H26O4 |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | butyl (E)-3-[(3aS,7aR)-2-oxo-3a-propyl-4,5-dihydro-3H-1-benzofuran-7a-yl]prop-2-enoate |
| SMILES | CCCCOC(=O)/C=C/[C@]12C=CCC[C@@]1(CCC)CC(=O)O2 |
| InChI | InChI=1S/C18H26O4/c1-3-5-13-21-15(19)8-12-18-11-7-6-10-17(18,9-4-2)14-16(20)22-18/h7-8,11-12H,3-6,9-10,13-14H2,1-2H3/b12-8+/t17-,18+/m0/s1 |
| InChIKey | JCVLQLPGUVPBJV-QGWFOHBRSA-N |
| XLogP | 3.71 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|