C17H24O3 — CID 169408949
(3aS,7aR)-3a-methyl-7a-[(E)-3-oxooct-1-enyl]-4,5-dihydro-3H-1-benzofuran-2-one (PubChem CID 169408949) has the molecular formula C17H24O3 and a molecular weight of 276.38 g/mol. Its IUPAC name is (3aS,7aR)-3a-methyl-7a-[(E)-3-oxooct-1-enyl]-4,5-dihydro-3H-1-benzofuran-2-one.
| Compound Name | (3aS,7aR)-3a-methyl-7a-[(E)-3-oxooct-1-enyl]-4,5-dihydro-3H-1-benzofuran-2-one |
|---|---|
| PubChem CID | 169408949 |
| Molecular Formula | C17H24O3 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | (3aS,7aR)-3a-methyl-7a-[(E)-3-oxooct-1-enyl]-4,5-dihydro-3H-1-benzofuran-2-one |
| SMILES | CCCCCC(=O)/C=C/[C@]12C=CCC[C@@]1(C)CC(=O)O2 |
| InChI | InChI=1S/C17H24O3/c1-3-4-5-8-14(18)9-12-17-11-7-6-10-16(17,2)13-15(19)20-17/h7,9,11-12H,3-6,8,10,13H2,1-2H3/b12-9+/t16-,17+/m0/s1 |
| InChIKey | WYXUPTYPYGGSTD-GYPZGHTGSA-N |
| XLogP | 3.73 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|