C26H38O6 — CID 169409684
bis(3-prop-2-ynoxypropyl) (5Z,9Z)-tetradeca-5,9-dienedioate (PubChem CID 169409684) has the molecular formula C26H38O6 and a molecular weight of 446.58 g/mol. Its IUPAC name is bis(3-prop-2-ynoxypropyl) (5Z,9Z)-tetradeca-5,9-dienedioate.
| Compound Name | bis(3-prop-2-ynoxypropyl) (5Z,9Z)-tetradeca-5,9-dienedioate |
|---|---|
| PubChem CID | 169409684 |
| Molecular Formula | C26H38O6 |
| Molecular Weight | 446.58 g/mol |
| Exact Mass | 446.27 |
| IUPAC Name | bis(3-prop-2-ynoxypropyl) (5Z,9Z)-tetradeca-5,9-dienedioate |
| SMILES | C#CCOCCCOC(=O)CCC/C=C\CC/C=C\CCCC(=O)OCCCOCC#C |
| InChI | InChI=1S/C26H38O6/c1-3-19-29-21-15-23-31-25(27)17-13-11-9-7-5-6-8-10-12-14-18-26(28)32-24-16-22-30-20-4-2/h1-2,7-10H,5-6,11-24H2/b9-7-,10-8- |
| InChIKey | UMMHROWEFQDBOG-XOHWUJONSA-N |
| XLogP | 4.39 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.58 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|