C33H21ClN6O5 — CID 169409790
2-[5-(4-chlorophenyl)-4,6-dioxo-1-phenyl-3-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)-1,3,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]isoindole-1,3-dione (PubChem CID 169409790) has the molecular formula C33H21ClN6O5 and a molecular weight of 617.02 g/mol. Its IUPAC name is 2-[5-(4-chlorophenyl)-4,6-dioxo-1-phenyl-3-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)-1,3,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]isoindole-1,3-dione.
| Compound Name | 2-[5-(4-chlorophenyl)-4,6-dioxo-1-phenyl-3-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)-1,3,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 169409790 |
| Molecular Formula | C33H21ClN6O5 |
| Molecular Weight | 617.02 g/mol |
| Exact Mass | 616.13 |
| IUPAC Name | 2-[5-(4-chlorophenyl)-4,6-dioxo-1-phenyl-3-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)-1,3,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]isoindole-1,3-dione |
| SMILES | O=C1C2C(C(=O)N1c1ccc(Cl)cc1)C(c1nc(-c3cccnc3)no1)N(N1C(=O)c3ccccc3C1=O)C2c1ccccc1 |
| InChI | InChI=1S/C33H21ClN6O5/c34-20-12-14-21(15-13-20)38-32(43)24-25(33(38)44)27(29-36-28(37-45-29)19-9-6-16-35-17-19)39(26(24)18-7-2-1-3-8-18)40-30(41)22-10-4-5-11-23(22)31(40)42/h1-17,24-27H |
| InChIKey | DWVCBQVSVSJQGH-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 129.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.02 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|