C34H23ClN6O5 — CID 169409796
2-[1-(3-chlorophenyl)-5-(4-methylphenyl)-4,6-dioxo-3-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)-1,3,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]isoindole-1,3-dione (PubChem CID 169409796) has the molecular formula C34H23ClN6O5 and a molecular weight of 631.05 g/mol. Its IUPAC name is 2-[1-(3-chlorophenyl)-5-(4-methylphenyl)-4,6-dioxo-3-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)-1,3,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]isoindole-1,3-dione.
| Compound Name | 2-[1-(3-chlorophenyl)-5-(4-methylphenyl)-4,6-dioxo-3-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)-1,3,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 169409796 |
| Molecular Formula | C34H23ClN6O5 |
| Molecular Weight | 631.05 g/mol |
| Exact Mass | 630.14 |
| IUPAC Name | 2-[1-(3-chlorophenyl)-5-(4-methylphenyl)-4,6-dioxo-3-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)-1,3,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]isoindole-1,3-dione |
| SMILES | Cc1ccc(N2C(=O)C3C(C2=O)C(c2nc(-c4cccnc4)no2)N(N2C(=O)c4ccccc4C2=O)C3c2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C34H23ClN6O5/c1-18-11-13-22(14-12-18)39-33(44)25-26(34(39)45)28(30-37-29(38-46-30)20-7-5-15-36-17-20)40(27(25)19-6-4-8-21(35)16-19)41-31(42)23-9-2-3-10-24(23)32(41)43/h2-17,25-28H,1H3 |
| InChIKey | UWBUWIUKMHPVHK-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 129.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.05 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|