C25H19ClN2O5 — CID 70697116
4-[(3R,3aS,6aR)-3-(3-chlorophenyl)-2-(4-methylphenyl)-4,6-dioxo-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-5-yl]benzoic acid (PubChem CID 70697116) has the molecular formula C25H19ClN2O5 and a molecular weight of 462.89 g/mol. Its IUPAC name is 4-[(3R,3aS,6aR)-3-(3-chlorophenyl)-2-(4-methylphenyl)-4,6-dioxo-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-5-yl]benzoic acid.
| Compound Name | 4-[(3R,3aS,6aR)-3-(3-chlorophenyl)-2-(4-methylphenyl)-4,6-dioxo-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-5-yl]benzoic acid |
|---|---|
| PubChem CID | 70697116 |
| Molecular Formula | C25H19ClN2O5 |
| Molecular Weight | 462.89 g/mol |
| Exact Mass | 462.10 |
| IUPAC Name | 4-[(3R,3aS,6aR)-3-(3-chlorophenyl)-2-(4-methylphenyl)-4,6-dioxo-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-5-yl]benzoic acid |
| SMILES | Cc1ccc(N2O[C@H]3C(=O)N(c4ccc(C(=O)O)cc4)C(=O)[C@H]3[C@@H]2c2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C25H19ClN2O5/c1-14-5-9-19(10-6-14)28-21(16-3-2-4-17(26)13-16)20-22(33-28)24(30)27(23(20)29)18-11-7-15(8-12-18)25(31)32/h2-13,20-22H,1H3,(H,31,32)/t20-,21-,22+/m0/s1 |
| InChIKey | GBHWTEZJSBLOAL-FDFHNCONSA-N |
| XLogP | 4.40 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.89 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|