C19H26Cl2N4O2 — CID 169413618
[(4aS,7aS)-4-methyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]-[4-[(3,5-dichloro-2-pyridinyl)amino]cyclohexyl]methanone (PubChem CID 169413618) has the molecular formula C19H26Cl2N4O2 and a molecular weight of 413.35 g/mol. Its IUPAC name is [(4aS,7aS)-4-methyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]-[4-[(3,5-dichloro-2-pyridinyl)amino]cyclohexyl]methanone.
| Compound Name | [(4aS,7aS)-4-methyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]-[4-[(3,5-dichloro-2-pyridinyl)amino]cyclohexyl]methanone |
|---|---|
| PubChem CID | 169413618 |
| Molecular Formula | C19H26Cl2N4O2 |
| Molecular Weight | 413.35 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | [(4aS,7aS)-4-methyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]-[4-[(3,5-dichloro-2-pyridinyl)amino]cyclohexyl]methanone |
| SMILES | CN1CCO[C@H]2CN(C(=O)C3CCC(Nc4ncc(Cl)cc4Cl)CC3)C[C@@H]21 |
| InChI | InChI=1S/C19H26Cl2N4O2/c1-24-6-7-27-17-11-25(10-16(17)24)19(26)12-2-4-14(5-3-12)23-18-15(21)8-13(20)9-22-18/h8-9,12,14,16-17H,2-7,10-11H2,1H3,(H,22,23)/t12?,14?,16-,17-/m0/s1 |
| InChIKey | YORNISXLZBYUDC-KNHPQMQCSA-N |
| XLogP | 2.90 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.35 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |