C20H32N4O3 — CID 169414385
2-[(1S,2S,4R)-2-(3-methylbutyl)-2-(3-pyrazol-1-ylpropylcarbamoyl)-7-azabicyclo[2.2.1]heptan-7-yl]acetic acid (PubChem CID 169414385) has the molecular formula C20H32N4O3 and a molecular weight of 376.50 g/mol. Its IUPAC name is 2-[(1S,2S,4R)-2-(3-methylbutyl)-2-(3-pyrazol-1-ylpropylcarbamoyl)-7-azabicyclo[2.2.1]heptan-7-yl]acetic acid.
| Compound Name | 2-[(1S,2S,4R)-2-(3-methylbutyl)-2-(3-pyrazol-1-ylpropylcarbamoyl)-7-azabicyclo[2.2.1]heptan-7-yl]acetic acid |
|---|---|
| PubChem CID | 169414385 |
| Molecular Formula | C20H32N4O3 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.25 |
| IUPAC Name | 2-[(1S,2S,4R)-2-(3-methylbutyl)-2-(3-pyrazol-1-ylpropylcarbamoyl)-7-azabicyclo[2.2.1]heptan-7-yl]acetic acid |
| SMILES | CC(C)CC[C@]1(C(=O)NCCCn2cccn2)C[C@H]2CC[C@@H]1N2CC(=O)O |
| InChI | InChI=1S/C20H32N4O3/c1-15(2)7-8-20(13-16-5-6-17(20)24(16)14-18(25)26)19(27)21-9-3-11-23-12-4-10-22-23/h4,10,12,15-17H,3,5-9,11,13-14H2,1-2H3,(H,21,27)(H,25,26)/t16-,17+,20+/m1/s1 |
| InChIKey | GKKXXIBHIIOFMV-UWVAXJGDSA-N |
| XLogP | 2.13 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|