C35H43FN6O4 — CID 169415230
(7S,10R)-12-[2-(3,5-dimethyl-1-phenylpyrazol-4-yl)acetyl]-22-fluoro-10-propan-2-yl-3,9,12,15-tetrazatricyclo[17.3.1.03,7]tricosa-1(22),19(23),20-triene-2,8,14-trione (PubChem CID 169415230) has the molecular formula C35H43FN6O4 and a molecular weight of 630.77 g/mol. Its IUPAC name is (7S,10R)-12-[2-(3,5-dimethyl-1-phenylpyrazol-4-yl)acetyl]-22-fluoro-10-propan-2-yl-3,9,12,15-tetrazatricyclo[17.3.1.03,7]tricosa-1(22),19(23),20-triene-2,8,14-trione.
| Compound Name | (7S,10R)-12-[2-(3,5-dimethyl-1-phenylpyrazol-4-yl)acetyl]-22-fluoro-10-propan-2-yl-3,9,12,15-tetrazatricyclo[17.3.1.03,7]tricosa-1(22),19(23),20-triene-2,8,14-trione |
|---|---|
| PubChem CID | 169415230 |
| Molecular Formula | C35H43FN6O4 |
| Molecular Weight | 630.77 g/mol |
| Exact Mass | 630.33 |
| IUPAC Name | (7S,10R)-12-[2-(3,5-dimethyl-1-phenylpyrazol-4-yl)acetyl]-22-fluoro-10-propan-2-yl-3,9,12,15-tetrazatricyclo[17.3.1.03,7]tricosa-1(22),19(23),20-triene-2,8,14-trione |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1CC(=O)N1CC(=O)NCCCc2ccc(F)c(c2)C(=O)N2CCC[C@H]2C(=O)N[C@H](C(C)C)C1 |
| InChI | InChI=1S/C35H43FN6O4/c1-22(2)30-20-40(33(44)19-27-23(3)39-42(24(27)4)26-11-6-5-7-12-26)21-32(43)37-16-8-10-25-14-15-29(36)28(18-25)35(46)41-17-9-13-31(41)34(45)38-30/h5-7,11-12,14-15,18,22,30-31H,8-10,13,16-17,19-21H2,1-4H3,(H,37,43)(H,38,45)/t30-,31-/m0/s1 |
| InChIKey | CFGSWPSMDAEPPK-CONSDPRKSA-N |
| XLogP | 3.51 |
| TPSA | 116.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.77 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |