C31H39FN6O3 — CID 170510622
(7S,10R)-22-fluoro-12-[(1-methylbenzimidazol-2-yl)methyl]-10-propan-2-yl-3,9,12,15-tetrazatricyclo[17.3.1.03,7]tricosa-1(22),19(23),20-triene-2,8,14-trione (PubChem CID 170510622) has the molecular formula C31H39FN6O3 and a molecular weight of 562.69 g/mol. Its IUPAC name is (7S,10R)-22-fluoro-12-[(1-methylbenzimidazol-2-yl)methyl]-10-propan-2-yl-3,9,12,15-tetrazatricyclo[17.3.1.03,7]tricosa-1(22),19(23),20-triene-2,8,14-trione.
| Compound Name | (7S,10R)-22-fluoro-12-[(1-methylbenzimidazol-2-yl)methyl]-10-propan-2-yl-3,9,12,15-tetrazatricyclo[17.3.1.03,7]tricosa-1(22),19(23),20-triene-2,8,14-trione |
|---|---|
| PubChem CID | 170510622 |
| Molecular Formula | C31H39FN6O3 |
| Molecular Weight | 562.69 g/mol |
| Exact Mass | 562.31 |
| IUPAC Name | (7S,10R)-22-fluoro-12-[(1-methylbenzimidazol-2-yl)methyl]-10-propan-2-yl-3,9,12,15-tetrazatricyclo[17.3.1.03,7]tricosa-1(22),19(23),20-triene-2,8,14-trione |
| SMILES | CC(C)[C@@H]1CN(Cc2nc3ccccc3n2C)CC(=O)NCCCc2ccc(F)c(c2)C(=O)N2CCC[C@H]2C(=O)N1 |
| InChI | InChI=1S/C31H39FN6O3/c1-20(2)25-17-37(18-28-34-24-9-4-5-10-26(24)36(28)3)19-29(39)33-14-6-8-21-12-13-23(32)22(16-21)31(41)38-15-7-11-27(38)30(40)35-25/h4-5,9-10,12-13,16,20,25,27H,6-8,11,14-15,17-19H2,1-3H3,(H,33,39)(H,35,40)/t25-,27-/m0/s1 |
| InChIKey | JXDQDLSDUAIEDL-BDYUSTAISA-N |
| XLogP | 3.02 |
| TPSA | 99.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.69 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |