C26H34FN5O3S — CID 170512203
(7S,10R)-22-fluoro-10-propan-2-yl-12-(1,3-thiazol-5-ylmethyl)-3,9,12,15-tetrazatricyclo[17.3.1.03,7]tricosa-1(22),19(23),20-triene-2,8,14-trione (PubChem CID 170512203) has the molecular formula C26H34FN5O3S and a molecular weight of 515.66 g/mol. Its IUPAC name is (7S,10R)-22-fluoro-10-propan-2-yl-12-(1,3-thiazol-5-ylmethyl)-3,9,12,15-tetrazatricyclo[17.3.1.03,7]tricosa-1(22),19(23),20-triene-2,8,14-trione.
| Compound Name | (7S,10R)-22-fluoro-10-propan-2-yl-12-(1,3-thiazol-5-ylmethyl)-3,9,12,15-tetrazatricyclo[17.3.1.03,7]tricosa-1(22),19(23),20-triene-2,8,14-trione |
|---|---|
| PubChem CID | 170512203 |
| Molecular Formula | C26H34FN5O3S |
| Molecular Weight | 515.66 g/mol |
| Exact Mass | 515.24 |
| IUPAC Name | (7S,10R)-22-fluoro-10-propan-2-yl-12-(1,3-thiazol-5-ylmethyl)-3,9,12,15-tetrazatricyclo[17.3.1.03,7]tricosa-1(22),19(23),20-triene-2,8,14-trione |
| SMILES | CC(C)[C@@H]1CN(Cc2cncs2)CC(=O)NCCCc2ccc(F)c(c2)C(=O)N2CCC[C@H]2C(=O)N1 |
| InChI | InChI=1S/C26H34FN5O3S/c1-17(2)22-14-31(13-19-12-28-16-36-19)15-24(33)29-9-3-5-18-7-8-21(27)20(11-18)26(35)32-10-4-6-23(32)25(34)30-22/h7-8,11-12,16-17,22-23H,3-6,9-10,13-15H2,1-2H3,(H,29,33)(H,30,34)/t22-,23-/m0/s1 |
| InChIKey | WEBRVASSTHEDFS-GOTSBHOMSA-N |
| XLogP | 2.59 |
| TPSA | 94.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.66 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |