C29H37FN4O5 — CID 169417490
(7S,10R)-12-(2,5-dimethylfuran-3-carbonyl)-22-fluoro-10-propan-2-yl-3,9,12,15-tetrazatricyclo[17.3.1.03,7]tricosa-1(22),19(23),20-triene-2,8,14-trione (PubChem CID 169417490) has the molecular formula C29H37FN4O5 and a molecular weight of 540.64 g/mol. Its IUPAC name is (7S,10R)-12-(2,5-dimethylfuran-3-carbonyl)-22-fluoro-10-propan-2-yl-3,9,12,15-tetrazatricyclo[17.3.1.03,7]tricosa-1(22),19(23),20-triene-2,8,14-trione.
| Compound Name | (7S,10R)-12-(2,5-dimethylfuran-3-carbonyl)-22-fluoro-10-propan-2-yl-3,9,12,15-tetrazatricyclo[17.3.1.03,7]tricosa-1(22),19(23),20-triene-2,8,14-trione |
|---|---|
| PubChem CID | 169417490 |
| Molecular Formula | C29H37FN4O5 |
| Molecular Weight | 540.64 g/mol |
| Exact Mass | 540.27 |
| IUPAC Name | (7S,10R)-12-(2,5-dimethylfuran-3-carbonyl)-22-fluoro-10-propan-2-yl-3,9,12,15-tetrazatricyclo[17.3.1.03,7]tricosa-1(22),19(23),20-triene-2,8,14-trione |
| SMILES | Cc1cc(C(=O)N2CC(=O)NCCCc3ccc(F)c(c3)C(=O)N3CCC[C@H]3C(=O)N[C@H](C(C)C)C2)c(C)o1 |
| InChI | InChI=1S/C29H37FN4O5/c1-17(2)24-15-33(28(37)21-13-18(3)39-19(21)4)16-26(35)31-11-5-7-20-9-10-23(30)22(14-20)29(38)34-12-6-8-25(34)27(36)32-24/h9-10,13-14,17,24-25H,5-8,11-12,15-16H2,1-4H3,(H,31,35)(H,32,36)/t24-,25-/m0/s1 |
| InChIKey | AHYRJYVHHBUSDD-DQEYMECFSA-N |
| XLogP | 2.99 |
| TPSA | 111.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.64 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |