C22H22FN3O4 — CID 169415501
8-[3-(2-fluoro-4-hydroxyphenyl)benzoyl]-1,3-dimethyl-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 169415501) has the molecular formula C22H22FN3O4 and a molecular weight of 411.43 g/mol. Its IUPAC name is 8-[3-(2-fluoro-4-hydroxyphenyl)benzoyl]-1,3-dimethyl-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 8-[3-(2-fluoro-4-hydroxyphenyl)benzoyl]-1,3-dimethyl-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 169415501 |
| Molecular Formula | C22H22FN3O4 |
| Molecular Weight | 411.43 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | 8-[3-(2-fluoro-4-hydroxyphenyl)benzoyl]-1,3-dimethyl-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | CN1C(=O)N(C)C2(CCN(C(=O)c3cccc(-c4ccc(O)cc4F)c3)CC2)C1=O |
| InChI | InChI=1S/C22H22FN3O4/c1-24-20(29)22(25(2)21(24)30)8-10-26(11-9-22)19(28)15-5-3-4-14(12-15)17-7-6-16(27)13-18(17)23/h3-7,12-13,27H,8-11H2,1-2H3 |
| InChIKey | ZINVGDSPVXIKRD-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.43 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|