C21H21N3O4 — CID 169416633
4-[6-[2-(1H-indol-3-yl)ethyl]-4-methyl-2-oxopyran-3-carbonyl]piperazin-2-one (PubChem CID 169416633) has the molecular formula C21H21N3O4 and a molecular weight of 379.42 g/mol. Its IUPAC name is 4-[6-[2-(1H-indol-3-yl)ethyl]-4-methyl-2-oxopyran-3-carbonyl]piperazin-2-one.
| Compound Name | 4-[6-[2-(1H-indol-3-yl)ethyl]-4-methyl-2-oxopyran-3-carbonyl]piperazin-2-one |
|---|---|
| PubChem CID | 169416633 |
| Molecular Formula | C21H21N3O4 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | 4-[6-[2-(1H-indol-3-yl)ethyl]-4-methyl-2-oxopyran-3-carbonyl]piperazin-2-one |
| SMILES | Cc1cc(CCc2c[nH]c3ccccc23)oc(=O)c1C(=O)N1CCNC(=O)C1 |
| InChI | InChI=1S/C21H21N3O4/c1-13-10-15(7-6-14-11-23-17-5-3-2-4-16(14)17)28-21(27)19(13)20(26)24-9-8-22-18(25)12-24/h2-5,10-11,23H,6-9,12H2,1H3,(H,22,25) |
| InChIKey | OWSPBZMOLWVKTD-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 95.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |