C16H17N3O2 — CID 169417475
6-(3,4-dimethoxyphenyl)-2,4-dimethylpyrazolo[3,4-b]pyridine (PubChem CID 169417475) has the molecular formula C16H17N3O2 and a molecular weight of 283.33 g/mol. Its IUPAC name is 6-(3,4-dimethoxyphenyl)-2,4-dimethylpyrazolo[3,4-b]pyridine.
| Compound Name | 6-(3,4-dimethoxyphenyl)-2,4-dimethylpyrazolo[3,4-b]pyridine |
|---|---|
| PubChem CID | 169417475 |
| Molecular Formula | C16H17N3O2 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | 6-(3,4-dimethoxyphenyl)-2,4-dimethylpyrazolo[3,4-b]pyridine |
| SMILES | COc1ccc(-c2cc(C)c3cn(C)nc3n2)cc1OC |
| InChI | InChI=1S/C16H17N3O2/c1-10-7-13(17-16-12(10)9-19(2)18-16)11-5-6-14(20-3)15(8-11)21-4/h5-9H,1-4H3 |
| InChIKey | IHFXKUGXLSERLS-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |