About 2-ethyl-6-(4-methoxy-2,3-dimethylphenyl)-4-methylpyrazolo[3,4-b]pyridine
2-ethyl-6-(4-methoxy-2,3-dimethylphenyl)-4-methylpyrazolo[3,4-b]pyridine (PubChem CID 169417519) has the molecular formula C18H21N3O
and a molecular weight of 295.39 g/mol. Its IUPAC name is 2-ethyl-6-(4-methoxy-2,3-dimethylphenyl)-4-methylpyrazolo[3,4-b]pyridine.
Molecular Properties
| Compound Name | 2-ethyl-6-(4-methoxy-2,3-dimethylphenyl)-4-methylpyrazolo[3,4-b]pyridine |
| PubChem CID | 169417519 |
| Molecular Formula | C18H21N3O |
| Molecular Weight | 295.39 g/mol |
| Exact Mass | 295.17 |
| IUPAC Name | 2-ethyl-6-(4-methoxy-2,3-dimethylphenyl)-4-methylpyrazolo[3,4-b]pyridine |
| SMILES | CCn1cc2c(C)cc(-c3ccc(OC)c(C)c3C)nc2n1 |
| InChI | InChI=1S/C18H21N3O/c1-6-21-10-15-11(2)9-16(19-18(15)20-21)14-7-8-17(22-5)13(4)12(14)3/h7-10H,6H2,1-5H3 |
| InChIKey | PCSRDPGFTPFMRA-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.39 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-ethyl-6-(4-methoxy-2,3-dimethylphenyl)-4-methylpyrazolo[3,4-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-6-(4-methoxy-2,3-dimethylphenyl)-4-methylpyrazolo[3,4-b]pyridine?
The IUPAC name of 2-ethyl-6-(4-methoxy-2,3-dimethylphenyl)-4-methylpyrazolo[3,4-b]pyridine (CID 169417519) is 2-ethyl-6-(4-methoxy-2,3-dimethylphenyl)-4-methylpyrazolo[3,4-b]pyridine.
What is the SMILES notation for 2-ethyl-6-(4-methoxy-2,3-dimethylphenyl)-4-methylpyrazolo[3,4-b]pyridine?
The canonical SMILES for 2-ethyl-6-(4-methoxy-2,3-dimethylphenyl)-4-methylpyrazolo[3,4-b]pyridine is CCn1cc2c(C)cc(-c3ccc(OC)c(C)c3C)nc2n1.
What is the InChIKey of 2-ethyl-6-(4-methoxy-2,3-dimethylphenyl)-4-methylpyrazolo[3,4-b]pyridine?
The InChIKey is PCSRDPGFTPFMRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21N3O/c1-6-21-10-15-11(2)9-16(19-18(15)20-21)14-7-8-17(22-5)13(4)12(14)3/h7-10H,6H2,1-5H3.
What are the key properties of 2-ethyl-6-(4-methoxy-2,3-dimethylphenyl)-4-methylpyrazolo[3,4-b]pyridine?
2-ethyl-6-(4-methoxy-2,3-dimethylphenyl)-4-methylpyrazolo[3,4-b]pyridine has a molecular weight of 295.39 g/mol, XLogP of 4.05, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-6-(4-methoxy-2,3-dimethylphenyl)-4-methylpyrazolo[3,4-b]pyridine is sourced from PubChem (CID 169417519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).