C20H29N3O4S — CID 169418417
3-(3,5-dimethyl-1,2-oxazol-4-yl)-N-[[(1S,5S,6R,7R)-3-(2-methylsulfanylacetyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]propanamide (PubChem CID 169418417) has the molecular formula C20H29N3O4S and a molecular weight of 407.54 g/mol. Its IUPAC name is 3-(3,5-dimethyl-1,2-oxazol-4-yl)-N-[[(1S,5S,6R,7R)-3-(2-methylsulfanylacetyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]propanamide.
| Compound Name | 3-(3,5-dimethyl-1,2-oxazol-4-yl)-N-[[(1S,5S,6R,7R)-3-(2-methylsulfanylacetyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]propanamide |
|---|---|
| PubChem CID | 169418417 |
| Molecular Formula | C20H29N3O4S |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.19 |
| IUPAC Name | 3-(3,5-dimethyl-1,2-oxazol-4-yl)-N-[[(1S,5S,6R,7R)-3-(2-methylsulfanylacetyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]propanamide |
| SMILES | CSCC(=O)N1C[C@@H]2[C@H](CNC(=O)CCc3c(C)noc3C)[C@H]3CC[C@]2(C1)O3 |
| InChI | InChI=1S/C20H29N3O4S/c1-12-14(13(2)27-22-12)4-5-18(24)21-8-15-16-9-23(19(25)10-28-3)11-20(16)7-6-17(15)26-20/h15-17H,4-11H2,1-3H3,(H,21,24)/t15-,16+,17+,20+/m0/s1 |
| InChIKey | PZQYHSMLVWBXCF-TVKQPGBESA-N |
| XLogP | 1.71 |
| TPSA | 84.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |