C19H25N5O2 — CID 169420316
1-methyl-N-[4-(2-pyridin-4-ylethylcarbamoyl)cyclohexyl]imidazole-2-carboxamide (PubChem CID 169420316) has the molecular formula C19H25N5O2 and a molecular weight of 355.44 g/mol. Its IUPAC name is 1-methyl-N-[4-(2-pyridin-4-ylethylcarbamoyl)cyclohexyl]imidazole-2-carboxamide.
| Compound Name | 1-methyl-N-[4-(2-pyridin-4-ylethylcarbamoyl)cyclohexyl]imidazole-2-carboxamide |
|---|---|
| PubChem CID | 169420316 |
| Molecular Formula | C19H25N5O2 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.20 |
| IUPAC Name | 1-methyl-N-[4-(2-pyridin-4-ylethylcarbamoyl)cyclohexyl]imidazole-2-carboxamide |
| SMILES | Cn1ccnc1C(=O)NC1CCC(C(=O)NCCc2ccncc2)CC1 |
| InChI | InChI=1S/C19H25N5O2/c1-24-13-12-21-17(24)19(26)23-16-4-2-15(3-5-16)18(25)22-11-8-14-6-9-20-10-7-14/h6-7,9-10,12-13,15-16H,2-5,8,11H2,1H3,(H,22,25)(H,23,26) |
| InChIKey | AFUOPRSGYOXLEM-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |