C29H34N4O8S2 — CID 169421562
3-[4-(dimethylsulfamoylamino)phenyl]sulfonyl-9-methoxy-13-oxo-11,18-dioxa-3,14-diazatetracyclo[17.3.1.16,10.02,7]tetracosa-1(23),6(24),7,9,19,21-hexaene (PubChem CID 169421562) has the molecular formula C29H34N4O8S2 and a molecular weight of 630.74 g/mol. Its IUPAC name is 3-[4-(dimethylsulfamoylamino)phenyl]sulfonyl-9-methoxy-13-oxo-11,18-dioxa-3,14-diazatetracyclo[17.3.1.16,10.02,7]tetracosa-1(23),6(24),7,9,19,21-hexaene.
| Compound Name | 3-[4-(dimethylsulfamoylamino)phenyl]sulfonyl-9-methoxy-13-oxo-11,18-dioxa-3,14-diazatetracyclo[17.3.1.16,10.02,7]tetracosa-1(23),6(24),7,9,19,21-hexaene |
|---|---|
| PubChem CID | 169421562 |
| Molecular Formula | C29H34N4O8S2 |
| Molecular Weight | 630.74 g/mol |
| Exact Mass | 630.18 |
| IUPAC Name | 3-[4-(dimethylsulfamoylamino)phenyl]sulfonyl-9-methoxy-13-oxo-11,18-dioxa-3,14-diazatetracyclo[17.3.1.16,10.02,7]tetracosa-1(23),6(24),7,9,19,21-hexaene |
| SMILES | COc1cc2c3cc1OCC(=O)NCCCOc1cccc(c1)C2N(S(=O)(=O)c1ccc(NS(=O)(=O)N(C)C)cc1)CC3 |
| InChI | InChI=1S/C29H34N4O8S2/c1-32(2)43(37,38)31-22-8-10-24(11-9-22)42(35,36)33-14-12-20-17-27-26(39-3)18-25(20)29(33)21-6-4-7-23(16-21)40-15-5-13-30-28(34)19-41-27/h4,6-11,16-18,29,31H,5,12-15,19H2,1-3H3,(H,30,34) |
| InChIKey | HCJODPUXEKHRAI-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 143.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.74 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |