C23H34ClN3O2S — CID 169428011
(2'R,3S,3'R,5'R)-6-chloro-3'-cyclopentyl-5'-(2,2-dimethylpropyl)-N-methyl-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carboxamide;sulfane (PubChem CID 169428011) has the molecular formula C23H34ClN3O2S and a molecular weight of 452.06 g/mol. Its IUPAC name is (2'R,3S,3'R,5'R)-6-chloro-3'-cyclopentyl-5'-(2,2-dimethylpropyl)-N-methyl-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carboxamide;sulfane.
| Compound Name | (2'R,3S,3'R,5'R)-6-chloro-3'-cyclopentyl-5'-(2,2-dimethylpropyl)-N-methyl-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carboxamide;sulfane |
|---|---|
| PubChem CID | 169428011 |
| Molecular Formula | C23H34ClN3O2S |
| Molecular Weight | 452.06 g/mol |
| Exact Mass | 451.21 |
| IUPAC Name | (2'R,3S,3'R,5'R)-6-chloro-3'-cyclopentyl-5'-(2,2-dimethylpropyl)-N-methyl-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carboxamide;sulfane |
| SMILES | CNC(=O)[C@@H]1N[C@H](CC(C)(C)C)[C@]2(C(=O)Nc3cc(Cl)ccc32)[C@H]1C1CCCC1.S |
| InChI | InChI=1S/C23H32ClN3O2.H2S/c1-22(2,3)12-17-23(15-10-9-14(24)11-16(15)26-21(23)29)18(13-7-5-6-8-13)19(27-17)20(28)25-4;/h9-11,13,17-19,27H,5-8,12H2,1-4H3,(H,25,28)(H,26,29);1H2/t17-,18+,19-,23+;/m1./s1 |
| InChIKey | OCFMAIHAWSEBMC-SXTPKTQFSA-N |
| XLogP | 3.97 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.06 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |