C14H24IN3 — CID 169428794
2,5,6-trimethyl-N-(4-methylcyclohexyl)pyrimidin-4-amine;hydroiodide (PubChem CID 169428794) has the molecular formula C14H24IN3 and a molecular weight of 361.27 g/mol. Its IUPAC name is 2,5,6-trimethyl-N-(4-methylcyclohexyl)pyrimidin-4-amine;hydroiodide.
| Compound Name | 2,5,6-trimethyl-N-(4-methylcyclohexyl)pyrimidin-4-amine;hydroiodide |
|---|---|
| PubChem CID | 169428794 |
| Molecular Formula | C14H24IN3 |
| Molecular Weight | 361.27 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | 2,5,6-trimethyl-N-(4-methylcyclohexyl)pyrimidin-4-amine;hydroiodide |
| SMILES | Cc1nc(C)c(C)c(NC2CCC(C)CC2)n1.I |
| InChI | InChI=1S/C14H23N3.HI/c1-9-5-7-13(8-6-9)17-14-10(2)11(3)15-12(4)16-14;/h9,13H,5-8H2,1-4H3,(H,15,16,17);1H |
| InChIKey | OVZOAQBAXCRBQC-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.27 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|