C18H25K — CID 169431254
potassium;hydride;1,2,3-trimethyl-6-pentylnaphthalene (PubChem CID 169431254) has the molecular formula C18H25K and a molecular weight of 280.50 g/mol. Its IUPAC name is potassium;hydride;1,2,3-trimethyl-6-pentylnaphthalene.
| Compound Name | potassium;hydride;1,2,3-trimethyl-6-pentylnaphthalene |
|---|---|
| PubChem CID | 169431254 |
| Molecular Formula | C18H25K |
| Molecular Weight | 280.50 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | potassium;hydride;1,2,3-trimethyl-6-pentylnaphthalene |
| SMILES | CCCCCc1ccc2c(C)c(C)c(C)cc2c1.[H-].[K+] |
| InChI | InChI=1S/C18H24.K.H/c1-5-6-7-8-16-9-10-18-15(4)14(3)13(2)11-17(18)12-16;;/h9-12H,5-8H2,1-4H3;;/q;+1;-1 |
| InChIKey | WOAPORBUBJMQHQ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.50 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|