C28H36O3 — CID 169432268
[(3S,8R,9S,10R,13S,14S)-10,13-dimethyl-17-oxo-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl] 4-(1,1,2,2,2-pentadeuterioethyl)benzoate (PubChem CID 169432268) has the molecular formula C28H36O3 and a molecular weight of 425.62 g/mol. Its IUPAC name is [(3S,8R,9S,10R,13S,14S)-10,13-dimethyl-17-oxo-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl] 4-(1,1,2,2,2-pentadeuterioethyl)benzoate.
| Compound Name | [(3S,8R,9S,10R,13S,14S)-10,13-dimethyl-17-oxo-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl] 4-(1,1,2,2,2-pentadeuterioethyl)benzoate |
|---|---|
| PubChem CID | 169432268 |
| Molecular Formula | C28H36O3 |
| Molecular Weight | 425.62 g/mol |
| Exact Mass | 425.30 |
| IUPAC Name | [(3S,8R,9S,10R,13S,14S)-10,13-dimethyl-17-oxo-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl] 4-(1,1,2,2,2-pentadeuterioethyl)benzoate |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])c1ccc(C(=O)O[C@H]2CC[C@@]3(C)C(=CC[C@@H]4[C@@H]3CC[C@]3(C)C(=O)CC[C@@H]43)C2)cc1 |
| InChI | InChI=1S/C28H36O3/c1-4-18-5-7-19(8-6-18)26(30)31-21-13-15-27(2)20(17-21)9-10-22-23-11-12-25(29)28(23,3)16-14-24(22)27/h5-9,21-24H,4,10-17H2,1-3H3/t21-,22-,23-,24-,27-,28-/m0/s1/i1D3,4D2 |
| InChIKey | CYPKBZPCFWNQPL-OGOOBDPWSA-N |
| XLogP | 6.31 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.62 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|