C8H8ClNO2 — CID 169436577
2-chloro-2,2-dideuterio-N-(2,3,5,6-tetradeuterio-4-hydroxyphenyl)acetamide (PubChem CID 169436577) has the molecular formula C8H8ClNO2 and a molecular weight of 191.65 g/mol. Its IUPAC name is 2-chloro-2,2-dideuterio-N-(2,3,5,6-tetradeuterio-4-hydroxyphenyl)acetamide.
| Compound Name | 2-chloro-2,2-dideuterio-N-(2,3,5,6-tetradeuterio-4-hydroxyphenyl)acetamide |
|---|---|
| PubChem CID | 169436577 |
| Molecular Formula | C8H8ClNO2 |
| Molecular Weight | 191.65 g/mol |
| Exact Mass | 191.06 |
| IUPAC Name | 2-chloro-2,2-dideuterio-N-(2,3,5,6-tetradeuterio-4-hydroxyphenyl)acetamide |
| SMILES | [2H]c1c([2H])c(NC(=O)C([2H])([2H])Cl)c([2H])c([2H])c1O |
| InChI | InChI=1S/C8H8ClNO2/c9-5-8(12)10-6-1-3-7(11)4-2-6/h1-4,11H,5H2,(H,10,12)/i1D,2D,3D,4D,5D2 |
| InChIKey | MOICCNYVOWJAOK-NVSFMWKBSA-N |
| XLogP | 1.57 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.65 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|