C10H6ClNO5-2 — CID 6988728
5-[(2-chloroacetyl)amino]benzene-1,3-dicarboxylate (PubChem CID 6988728) has the molecular formula C10H6ClNO5-2 and a molecular weight of 255.61 g/mol. Its IUPAC name is 5-[(2-chloroacetyl)amino]benzene-1,3-dicarboxylate.
| Compound Name | 5-[(2-chloroacetyl)amino]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 6988728 |
| Molecular Formula | C10H6ClNO5-2 |
| Molecular Weight | 255.61 g/mol |
| Exact Mass | 254.99 |
| IUPAC Name | 5-[(2-chloroacetyl)amino]benzene-1,3-dicarboxylate |
| SMILES | O=C(CCl)Nc1cc(C(=O)[O-])cc(C(=O)[O-])c1 |
| InChI | InChI=1S/C10H8ClNO5/c11-4-8(13)12-7-2-5(9(14)15)1-6(3-7)10(16)17/h1-3H,4H2,(H,12,13)(H,14,15)(H,16,17)/p-2 |
| InChIKey | JIXLTJSFSIQKEI-UHFFFAOYSA-L |
| XLogP | -1.41 |
| TPSA | 109.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.61 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|