C12H11Cl2NO4 — CID 167658726
3-[(2-chloroacetyl)amino]-5-(3-chloro-2-oxopropyl)benzoic acid (PubChem CID 167658726) has the molecular formula C12H11Cl2NO4 and a molecular weight of 304.13 g/mol. Its IUPAC name is 3-[(2-chloroacetyl)amino]-5-(3-chloro-2-oxopropyl)benzoic acid.
| Compound Name | 3-[(2-chloroacetyl)amino]-5-(3-chloro-2-oxopropyl)benzoic acid |
|---|---|
| PubChem CID | 167658726 |
| Molecular Formula | C12H11Cl2NO4 |
| Molecular Weight | 304.13 g/mol |
| Exact Mass | 303.01 |
| IUPAC Name | 3-[(2-chloroacetyl)amino]-5-(3-chloro-2-oxopropyl)benzoic acid |
| SMILES | O=C(CCl)Cc1cc(NC(=O)CCl)cc(C(=O)O)c1 |
| InChI | InChI=1S/C12H11Cl2NO4/c13-5-10(16)3-7-1-8(12(18)19)4-9(2-7)15-11(17)6-14/h1-2,4H,3,5-6H2,(H,15,17)(H,18,19) |
| InChIKey | RQINMXAZEPGOKY-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.13 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|