C16H10Cl6N4O2 — CID 102528845
2-chloro-N-[3,5-dichloro-4-[[2,6-dichloro-4-[(2-chloroacetyl)amino]phenyl]diazenyl]phenyl]acetamide (PubChem CID 102528845) has the molecular formula C16H10Cl6N4O2 and a molecular weight of 503.00 g/mol. Its IUPAC name is 2-chloro-N-[3,5-dichloro-4-[[2,6-dichloro-4-[(2-chloroacetyl)amino]phenyl]diazenyl]phenyl]acetamide.
| Compound Name | 2-chloro-N-[3,5-dichloro-4-[[2,6-dichloro-4-[(2-chloroacetyl)amino]phenyl]diazenyl]phenyl]acetamide |
|---|---|
| PubChem CID | 102528845 |
| Molecular Formula | C16H10Cl6N4O2 |
| Molecular Weight | 503.00 g/mol |
| Exact Mass | 499.89 |
| IUPAC Name | 2-chloro-N-[3,5-dichloro-4-[[2,6-dichloro-4-[(2-chloroacetyl)amino]phenyl]diazenyl]phenyl]acetamide |
| SMILES | O=C(CCl)Nc1cc(Cl)c(/N=N/c2c(Cl)cc(NC(=O)CCl)cc2Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H10Cl6N4O2/c17-5-13(27)23-7-1-9(19)15(10(20)2-7)25-26-16-11(21)3-8(4-12(16)22)24-14(28)6-18/h1-4H,5-6H2,(H,23,27)(H,24,28)/b26-25+ |
| InChIKey | ZSXLRUGFBOJTAC-OCEACIFDSA-N |
| XLogP | 7.07 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.00 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|