C9H9Cl2NO2 — CID 167990561
2-chloro-N-[3-chloro-4-(hydroxymethyl)phenyl]acetamide (PubChem CID 167990561) has the molecular formula C9H9Cl2NO2 and a molecular weight of 234.08 g/mol. Its IUPAC name is 2-chloro-N-[3-chloro-4-(hydroxymethyl)phenyl]acetamide.
| Compound Name | 2-chloro-N-[3-chloro-4-(hydroxymethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 167990561 |
| Molecular Formula | C9H9Cl2NO2 |
| Molecular Weight | 234.08 g/mol |
| Exact Mass | 233.00 |
| IUPAC Name | 2-chloro-N-[3-chloro-4-(hydroxymethyl)phenyl]acetamide |
| SMILES | O=C(CCl)Nc1ccc(CO)c(Cl)c1 |
| InChI | InChI=1S/C9H9Cl2NO2/c10-4-9(14)12-7-2-1-6(5-13)8(11)3-7/h1-3,13H,4-5H2,(H,12,14) |
| InChIKey | XZIOEVMRMJBWRO-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.08 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|