C8H8ClNO3 — CID 18621844
[3-chloro-4-(hydroxymethyl)phenyl]carbamic acid (PubChem CID 18621844) has the molecular formula C8H8ClNO3 and a molecular weight of 201.61 g/mol. Its IUPAC name is [3-chloro-4-(hydroxymethyl)phenyl]carbamic acid.
| Compound Name | [3-chloro-4-(hydroxymethyl)phenyl]carbamic acid |
|---|---|
| PubChem CID | 18621844 |
| Molecular Formula | C8H8ClNO3 |
| Molecular Weight | 201.61 g/mol |
| Exact Mass | 201.02 |
| IUPAC Name | [3-chloro-4-(hydroxymethyl)phenyl]carbamic acid |
| SMILES | O=C(O)Nc1ccc(CO)c(Cl)c1 |
| InChI | InChI=1S/C8H8ClNO3/c9-7-3-6(10-8(12)13)2-1-5(7)4-11/h1-3,10-11H,4H2,(H,12,13) |
| InChIKey | KDWCWBQWGLCZCH-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.61 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |