C12H16N5Na2O6P — CID 169439521
disodium;[(2R,3S,5R)-5-[6-(dimethylamino)purin-9-yl]-3-hydroxyoxolan-2-yl]methyl phosphate (PubChem CID 169439521) has the molecular formula C12H16N5Na2O6P and a molecular weight of 403.24 g/mol. Its IUPAC name is disodium;[(2R,3S,5R)-5-[6-(dimethylamino)purin-9-yl]-3-hydroxyoxolan-2-yl]methyl phosphate.
| Compound Name | disodium;[(2R,3S,5R)-5-[6-(dimethylamino)purin-9-yl]-3-hydroxyoxolan-2-yl]methyl phosphate |
|---|---|
| PubChem CID | 169439521 |
| Molecular Formula | C12H16N5Na2O6P |
| Molecular Weight | 403.24 g/mol |
| Exact Mass | 403.06 |
| IUPAC Name | disodium;[(2R,3S,5R)-5-[6-(dimethylamino)purin-9-yl]-3-hydroxyoxolan-2-yl]methyl phosphate |
| SMILES | CN(C)c1ncnc2c1ncn2[C@H]1C[C@H](O)[C@@H](COP(=O)([O-])[O-])O1.[Na+].[Na+] |
| InChI | InChI=1S/C12H18N5O6P.2Na/c1-16(2)11-10-12(14-5-13-11)17(6-15-10)9-3-7(18)8(23-9)4-22-24(19,20)21;;/h5-9,18H,3-4H2,1-2H3,(H2,19,20,21);;/q;2*+1/p-2/t7-,8+,9+;;/m0../s1 |
| InChIKey | HXJOEINTSIVUEE-CVTHISEESA-L |
| XLogP | -7.61 |
| TPSA | 148.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.24 |
| LogP ≤ 5 | -7.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|