C18H23NOS — CID 169439623
(6S)-6-[1,1,2,2,2-pentadeuterioethyl(2-thiophen-2-ylethyl)amino]-5,6,7,8-tetrahydronaphthalen-1-ol (PubChem CID 169439623) has the molecular formula C18H23NOS and a molecular weight of 306.49 g/mol. Its IUPAC name is (6S)-6-[1,1,2,2,2-pentadeuterioethyl(2-thiophen-2-ylethyl)amino]-5,6,7,8-tetrahydronaphthalen-1-ol.
| Compound Name | (6S)-6-[1,1,2,2,2-pentadeuterioethyl(2-thiophen-2-ylethyl)amino]-5,6,7,8-tetrahydronaphthalen-1-ol |
|---|---|
| PubChem CID | 169439623 |
| Molecular Formula | C18H23NOS |
| Molecular Weight | 306.49 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | (6S)-6-[1,1,2,2,2-pentadeuterioethyl(2-thiophen-2-ylethyl)amino]-5,6,7,8-tetrahydronaphthalen-1-ol |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])N(CCc1cccs1)[C@H]1CCc2c(O)cccc2C1 |
| InChI | InChI=1S/C18H23NOS/c1-2-19(11-10-16-6-4-12-21-16)15-8-9-17-14(13-15)5-3-7-18(17)20/h3-7,12,15,20H,2,8-11,13H2,1H3/t15-/m0/s1/i1D3,2D2 |
| InChIKey | MGQHYAUEAZJTOP-MQRKACDYSA-N |
| XLogP | 3.88 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.49 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |