C25H39N5O3S — CID 50917218
(2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;(6S)-6-[propyl(2-thiophen-2-ylethyl)amino]-5,6,7,8-tetrahydronaphthalen-1-ol (PubChem CID 50917218) has the molecular formula C25H39N5O3S and a molecular weight of 489.69 g/mol. Its IUPAC name is (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;(6S)-6-[propyl(2-thiophen-2-ylethyl)amino]-5,6,7,8-tetrahydronaphthalen-1-ol.
| Compound Name | (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;(6S)-6-[propyl(2-thiophen-2-ylethyl)amino]-5,6,7,8-tetrahydronaphthalen-1-ol |
|---|---|
| PubChem CID | 50917218 |
| Molecular Formula | C25H39N5O3S |
| Molecular Weight | 489.69 g/mol |
| Exact Mass | 489.28 |
| IUPAC Name | (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;(6S)-6-[propyl(2-thiophen-2-ylethyl)amino]-5,6,7,8-tetrahydronaphthalen-1-ol |
| SMILES | CCCN(CCc1cccs1)[C@H]1CCc2c(O)cccc2C1.NC(N)=NCCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C19H25NOS.C6H14N4O2/c1-2-11-20(12-10-17-6-4-13-22-17)16-8-9-18-15(14-16)5-3-7-19(18)21;7-4(5(11)12)2-1-3-10-6(8)9/h3-7,13,16,21H,2,8-12,14H2,1H3;4H,1-3,7H2,(H,11,12)(H4,8,9,10)/t16-;4-/m00/s1 |
| InChIKey | JDAXROLKEQZOOQ-FURPCPQMSA-N |
| XLogP | 2.72 |
| TPSA | 151.19 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.69 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|