C38H51N2O6PS2-2 — CID 50916842
hydrogen phosphate;bis((6S)-6-[propyl(2-thiophen-2-ylethyl)amino]-5,6,7,8-tetrahydronaphthalen-1-ol) (PubChem CID 50916842) has the molecular formula C38H51N2O6PS2-2 and a molecular weight of 726.94 g/mol. Its IUPAC name is hydrogen phosphate;bis((6S)-6-[propyl(2-thiophen-2-ylethyl)amino]-5,6,7,8-tetrahydronaphthalen-1-ol).
| Compound Name | hydrogen phosphate;bis((6S)-6-[propyl(2-thiophen-2-ylethyl)amino]-5,6,7,8-tetrahydronaphthalen-1-ol) |
|---|---|
| PubChem CID | 50916842 |
| Molecular Formula | C38H51N2O6PS2-2 |
| Molecular Weight | 726.94 g/mol |
| Exact Mass | 726.29 |
| IUPAC Name | hydrogen phosphate;bis((6S)-6-[propyl(2-thiophen-2-ylethyl)amino]-5,6,7,8-tetrahydronaphthalen-1-ol) |
| SMILES | CCCN(CCc1cccs1)[C@H]1CCc2c(O)cccc2C1.CCCN(CCc1cccs1)[C@H]1CCc2c(O)cccc2C1.O=P([O-])([O-])O |
| InChI | InChI=1S/2C19H25NOS.H3O4P/c2*1-2-11-20(12-10-17-6-4-13-22-17)16-8-9-18-15(14-16)5-3-7-19(18)21;1-5(2,3)4/h2*3-7,13,16,21H,2,8-12,14H2,1H3;(H3,1,2,3,4)/p-2/t2*16-;/m00./s1 |
| InChIKey | MFKOTEZFKRFYPM-WUBQCMAVSA-L |
| XLogP | 6.34 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.94 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|