C24H25F2NO3 — CID 169440377
(1S,4R)-1-(4-fluorophenyl)-4-[(S)-(4-hydroxyphenyl)-(2,3,5,6-tetradeuterio-4-fluoroanilino)methyl]pentane-1,5-diol (PubChem CID 169440377) has the molecular formula C24H25F2NO3 and a molecular weight of 417.49 g/mol. Its IUPAC name is (1S,4R)-1-(4-fluorophenyl)-4-[(S)-(4-hydroxyphenyl)-(2,3,5,6-tetradeuterio-4-fluoroanilino)methyl]pentane-1,5-diol.
| Compound Name | (1S,4R)-1-(4-fluorophenyl)-4-[(S)-(4-hydroxyphenyl)-(2,3,5,6-tetradeuterio-4-fluoroanilino)methyl]pentane-1,5-diol |
|---|---|
| PubChem CID | 169440377 |
| Molecular Formula | C24H25F2NO3 |
| Molecular Weight | 417.49 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | (1S,4R)-1-(4-fluorophenyl)-4-[(S)-(4-hydroxyphenyl)-(2,3,5,6-tetradeuterio-4-fluoroanilino)methyl]pentane-1,5-diol |
| SMILES | [2H]c1c([2H])c(N[C@H](c2ccc(O)cc2)[C@H](CO)CC[C@H](O)c2ccc(F)cc2)c([2H])c([2H])c1F |
| InChI | InChI=1S/C24H25F2NO3/c25-19-6-1-16(2-7-19)23(30)14-5-18(15-28)24(17-3-12-22(29)13-4-17)27-21-10-8-20(26)9-11-21/h1-4,6-13,18,23-24,27-30H,5,14-15H2/t18-,23-,24+/m0/s1/i8D,9D,10D,11D |
| InChIKey | MGEXACDCGCPXOT-PEQVVBOYSA-N |
| XLogP | 4.95 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.49 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |