C17H32O5 — CID 169441430
(1,1,2,3,3-pentadeuterio-2-heptanoyloxy-3-hydroxypropyl) heptanoate (PubChem CID 169441430) has the molecular formula C17H32O5 and a molecular weight of 321.47 g/mol. Its IUPAC name is (1,1,2,3,3-pentadeuterio-2-heptanoyloxy-3-hydroxypropyl) heptanoate.
| Compound Name | (1,1,2,3,3-pentadeuterio-2-heptanoyloxy-3-hydroxypropyl) heptanoate |
|---|---|
| PubChem CID | 169441430 |
| Molecular Formula | C17H32O5 |
| Molecular Weight | 321.47 g/mol |
| Exact Mass | 321.26 |
| IUPAC Name | (1,1,2,3,3-pentadeuterio-2-heptanoyloxy-3-hydroxypropyl) heptanoate |
| SMILES | [2H]C([2H])(O)C([2H])(OC(=O)CCCCCC)C([2H])([2H])OC(=O)CCCCCC |
| InChI | InChI=1S/C17H32O5/c1-3-5-7-9-11-16(19)21-14-15(13-18)22-17(20)12-10-8-6-4-2/h15,18H,3-14H2,1-2H3/i13D2,14D2,15D |
| InChIKey | LUQFGNDRPGBWIS-UHHSBYFWSA-N |
| XLogP | 3.37 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.47 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|