C54H98O6 — CID 173002983
[1,1,2,3,3-pentadeuterio-2,3-bis[[(Z)-heptadec-11-enoyl]oxy]propyl] (Z)-heptadec-11-enoate (PubChem CID 173002983) has the molecular formula C54H98O6 and a molecular weight of 848.40 g/mol. Its IUPAC name is [1,1,2,3,3-pentadeuterio-2,3-bis[[(Z)-heptadec-11-enoyl]oxy]propyl] (Z)-heptadec-11-enoate.
| Compound Name | [1,1,2,3,3-pentadeuterio-2,3-bis[[(Z)-heptadec-11-enoyl]oxy]propyl] (Z)-heptadec-11-enoate |
|---|---|
| PubChem CID | 173002983 |
| Molecular Formula | C54H98O6 |
| Molecular Weight | 848.40 g/mol |
| Exact Mass | 847.77 |
| IUPAC Name | [1,1,2,3,3-pentadeuterio-2,3-bis[[(Z)-heptadec-11-enoyl]oxy]propyl] (Z)-heptadec-11-enoate |
| SMILES | [2H]C([2H])(OC(=O)CCCCCCCCC/C=C\CCCCC)C([2H])(OC(=O)CCCCCCCCC/C=C\CCCCC)C([2H])([2H])OC(=O)CCCCCCCCC/C=C\CCCCC |
| InChI | InChI=1S/C54H98O6/c1-4-7-10-13-16-19-22-25-28-31-34-37-40-43-46-52(55)58-49-51(60-54(57)48-45-42-39-36-33-30-27-24-21-18-15-12-9-6-3)50-59-53(56)47-44-41-38-35-32-29-26-23-20-17-14-11-8-5-2/h16-21,51H,4-15,22-50H2,1-3H3/b19-16-,20-17-,21-18-/i49D2,50D2,51D |
| InChIKey | OPJJLUSRUKHUFU-YWANIQAHSA-N |
| XLogP | 16.93 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 47 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 848.40 |
| LogP ≤ 5 | 16.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|