C21H39ClO3 — CID 71751309
(1-chloro-1,1,2,3,3-pentadeuterio-3-hydroxypropan-2-yl) (Z)-octadec-9-enoate (PubChem CID 71751309) has the molecular formula C21H39ClO3 and a molecular weight of 380.02 g/mol. Its IUPAC name is (1-chloro-1,1,2,3,3-pentadeuterio-3-hydroxypropan-2-yl) (Z)-octadec-9-enoate.
| Compound Name | (1-chloro-1,1,2,3,3-pentadeuterio-3-hydroxypropan-2-yl) (Z)-octadec-9-enoate |
|---|---|
| PubChem CID | 71751309 |
| Molecular Formula | C21H39ClO3 |
| Molecular Weight | 380.02 g/mol |
| Exact Mass | 379.29 |
| IUPAC Name | (1-chloro-1,1,2,3,3-pentadeuterio-3-hydroxypropan-2-yl) (Z)-octadec-9-enoate |
| SMILES | [2H]C([2H])(O)C([2H])(OC(=O)CCCCCCC/C=C\CCCCCCCC)C([2H])([2H])Cl |
| InChI | InChI=1S/C21H39ClO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21(24)25-20(18-22)19-23/h9-10,20,23H,2-8,11-19H2,1H3/b10-9-/i18D2,19D2,20D |
| InChIKey | SQEOYUUMBWVKDM-FNKKQMTJSA-N |
| XLogP | 6.17 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.02 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|