C39H69ClO4 — CID 132939547
[(2R)-2-chloro-1,1,2,3,3-pentadeuterio-3-[(9Z,12Z)-octadeca-9,12-dienoyl]oxypropyl] (Z)-octadec-9-enoate (PubChem CID 132939547) has the molecular formula C39H69ClO4 and a molecular weight of 642.46 g/mol. Its IUPAC name is [(2R)-2-chloro-1,1,2,3,3-pentadeuterio-3-[(9Z,12Z)-octadeca-9,12-dienoyl]oxypropyl] (Z)-octadec-9-enoate.
| Compound Name | [(2R)-2-chloro-1,1,2,3,3-pentadeuterio-3-[(9Z,12Z)-octadeca-9,12-dienoyl]oxypropyl] (Z)-octadec-9-enoate |
|---|---|
| PubChem CID | 132939547 |
| Molecular Formula | C39H69ClO4 |
| Molecular Weight | 642.46 g/mol |
| Exact Mass | 641.52 |
| IUPAC Name | [(2R)-2-chloro-1,1,2,3,3-pentadeuterio-3-[(9Z,12Z)-octadeca-9,12-dienoyl]oxypropyl] (Z)-octadec-9-enoate |
| SMILES | [2H]C([2H])(OC(=O)CCCCCCC/C=C\C/C=C\CCCCC)[C@]([2H])(Cl)C([2H])([2H])OC(=O)CCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C39H69ClO4/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-38(41)43-35-37(40)36-44-39(42)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h11,13,17-20,37H,3-10,12,14-16,21-36H2,1-2H3/b13-11-,19-17-,20-18-/t37-/m0/s1/i35D2,36D2,37D |
| InChIKey | ZMFJCZXJMLCEFW-IEXJPLPKSA-N |
| XLogP | 12.53 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.46 |
| LogP ≤ 5 | 12.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|