C17H12N4O2 — CID 169442887
4-[(4-cyanophenyl)-(1,2,4-triazol-1-yl)methyl]benzoic acid (PubChem CID 169442887) has the molecular formula C17H12N4O2 and a molecular weight of 304.31 g/mol. Its IUPAC name is 4-[(4-cyanophenyl)-(1,2,4-triazol-1-yl)methyl]benzoic acid.
| Compound Name | 4-[(4-cyanophenyl)-(1,2,4-triazol-1-yl)methyl]benzoic acid |
|---|---|
| PubChem CID | 169442887 |
| Molecular Formula | C17H12N4O2 |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | 4-[(4-cyanophenyl)-(1,2,4-triazol-1-yl)methyl]benzoic acid |
| SMILES | N#Cc1ccc(C(c2ccc(C(=O)O)cc2)n2cncn2)cc1 |
| InChI | InChI=1S/C17H12N4O2/c18-9-12-1-3-13(4-2-12)16(21-11-19-10-20-21)14-5-7-15(8-6-14)17(22)23/h1-8,10-11,16H,(H,22,23) |
| InChIKey | SLIQTVBHIQTJBJ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 91.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |