C20H22N4O2 — CID 154686668
4-[4-[2,2-dimethyl-1-(1,2,4-triazol-1-yl)propyl]anilino]benzoic acid (PubChem CID 154686668) has the molecular formula C20H22N4O2 and a molecular weight of 350.42 g/mol. Its IUPAC name is 4-[4-[2,2-dimethyl-1-(1,2,4-triazol-1-yl)propyl]anilino]benzoic acid.
| Compound Name | 4-[4-[2,2-dimethyl-1-(1,2,4-triazol-1-yl)propyl]anilino]benzoic acid |
|---|---|
| PubChem CID | 154686668 |
| Molecular Formula | C20H22N4O2 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | 4-[4-[2,2-dimethyl-1-(1,2,4-triazol-1-yl)propyl]anilino]benzoic acid |
| SMILES | CC(C)(C)C(c1ccc(Nc2ccc(C(=O)O)cc2)cc1)n1cncn1 |
| InChI | InChI=1S/C20H22N4O2/c1-20(2,3)18(24-13-21-12-22-24)14-4-8-16(9-5-14)23-17-10-6-15(7-11-17)19(25)26/h4-13,18,23H,1-3H3,(H,25,26) |
| InChIKey | FRORMWWBTJGMMF-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |