C17H15N5O2 — CID 91266908
1-[bis[4-(nitrosomethyl)phenyl]methyl]-1,2,4-triazole (PubChem CID 91266908) has the molecular formula C17H15N5O2 and a molecular weight of 321.34 g/mol. Its IUPAC name is 1-[bis[4-(nitrosomethyl)phenyl]methyl]-1,2,4-triazole.
| Compound Name | 1-[bis[4-(nitrosomethyl)phenyl]methyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 91266908 |
| Molecular Formula | C17H15N5O2 |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | 1-[bis[4-(nitrosomethyl)phenyl]methyl]-1,2,4-triazole |
| SMILES | O=NCc1ccc(C(c2ccc(CN=O)cc2)n2cncn2)cc1 |
| InChI | InChI=1S/C17H15N5O2/c23-20-9-13-1-5-15(6-2-13)17(22-12-18-11-19-22)16-7-3-14(4-8-16)10-21-24/h1-8,11-12,17H,9-10H2 |
| InChIKey | JOIMDSOAYGHCHW-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 89.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |