C19H16N4O2 — CID 174515024
4-methyl-6-[phenyl(1,2,4-triazol-1-yl)methyl]-1,4-benzoxazine-3-carbaldehyde (PubChem CID 174515024) has the molecular formula C19H16N4O2 and a molecular weight of 332.36 g/mol. Its IUPAC name is 4-methyl-6-[phenyl(1,2,4-triazol-1-yl)methyl]-1,4-benzoxazine-3-carbaldehyde.
| Compound Name | 4-methyl-6-[phenyl(1,2,4-triazol-1-yl)methyl]-1,4-benzoxazine-3-carbaldehyde |
|---|---|
| PubChem CID | 174515024 |
| Molecular Formula | C19H16N4O2 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | 4-methyl-6-[phenyl(1,2,4-triazol-1-yl)methyl]-1,4-benzoxazine-3-carbaldehyde |
| SMILES | CN1C(C=O)=COc2ccc(C(c3ccccc3)n3cncn3)cc21 |
| InChI | InChI=1S/C19H16N4O2/c1-22-16(10-24)11-25-18-8-7-15(9-17(18)22)19(23-13-20-12-21-23)14-5-3-2-4-6-14/h2-13,19H,1H3 |
| InChIKey | PIWYACCPMDMRGP-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|