C19H13F3N4O — CID 54014900
1-oxido-6-[(R)-1,2,4-triazol-1-yl-[3-(trifluoromethyl)phenyl]methyl]quinolin-1-ium (PubChem CID 54014900) has the molecular formula C19H13F3N4O and a molecular weight of 370.33 g/mol. Its IUPAC name is 1-oxido-6-[(R)-1,2,4-triazol-1-yl-[3-(trifluoromethyl)phenyl]methyl]quinolin-1-ium.
| Compound Name | 1-oxido-6-[(R)-1,2,4-triazol-1-yl-[3-(trifluoromethyl)phenyl]methyl]quinolin-1-ium |
|---|---|
| PubChem CID | 54014900 |
| Molecular Formula | C19H13F3N4O |
| Molecular Weight | 370.33 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | 1-oxido-6-[(R)-1,2,4-triazol-1-yl-[3-(trifluoromethyl)phenyl]methyl]quinolin-1-ium |
| SMILES | [O-][n+]1cccc2cc([C@H](c3cccc(C(F)(F)F)c3)n3cncn3)ccc21 |
| InChI | InChI=1S/C19H13F3N4O/c20-19(21,22)16-5-1-3-14(10-16)18(25-12-23-11-24-25)15-6-7-17-13(9-15)4-2-8-26(17)27/h1-12,18H/t18-/m0/s1 |
| InChIKey | KUYJDHPESLQMHB-SFHVURJKSA-N |
| XLogP | 3.72 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.33 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|