C9H17NOS — CID 169444191
S-(1,1,2,2,2-pentadeuterioethyl) azepane-1-carbothioate (PubChem CID 169444191) has the molecular formula C9H17NOS and a molecular weight of 192.34 g/mol. Its IUPAC name is S-(1,1,2,2,2-pentadeuterioethyl) azepane-1-carbothioate.
| Compound Name | S-(1,1,2,2,2-pentadeuterioethyl) azepane-1-carbothioate |
|---|---|
| PubChem CID | 169444191 |
| Molecular Formula | C9H17NOS |
| Molecular Weight | 192.34 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | S-(1,1,2,2,2-pentadeuterioethyl) azepane-1-carbothioate |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])SC(=O)N1CCCCCC1 |
| InChI | InChI=1S/C9H17NOS/c1-2-12-9(11)10-7-5-3-4-6-8-10/h2-8H2,1H3/i1D3,2D2 |
| InChIKey | DEDOPGXGGQYYMW-ZBJDZAJPSA-N |
| XLogP | 2.74 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.34 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|