About S-(2-aminoethyl) piperidine-1-carbothioate
S-(2-aminoethyl) piperidine-1-carbothioate (PubChem CID 19851804) has the molecular formula C8H16N2OS
and a molecular weight of 188.30 g/mol. Its IUPAC name is S-(2-aminoethyl) piperidine-1-carbothioate.
Molecular Properties
| Compound Name | S-(2-aminoethyl) piperidine-1-carbothioate |
| PubChem CID | 19851804 |
| Molecular Formula | C8H16N2OS |
| Molecular Weight | 188.30 g/mol |
| Exact Mass | 188.10 |
| IUPAC Name | S-(2-aminoethyl) piperidine-1-carbothioate |
| SMILES | NCCSC(=O)N1CCCCC1 |
| InChI | InChI=1S/C8H16N2OS/c9-4-7-12-8(11)10-5-2-1-3-6-10/h1-7,9H2 |
| InChIKey | GWRZBVOUQRBUJC-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.30 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(2-aminoethyl) piperidine-1-carbothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(2-aminoethyl) piperidine-1-carbothioate?
The IUPAC name of S-(2-aminoethyl) piperidine-1-carbothioate (CID 19851804) is S-(2-aminoethyl) piperidine-1-carbothioate.
What is the SMILES notation for S-(2-aminoethyl) piperidine-1-carbothioate?
The canonical SMILES for S-(2-aminoethyl) piperidine-1-carbothioate is NCCSC(=O)N1CCCCC1.
What is the InChIKey of S-(2-aminoethyl) piperidine-1-carbothioate?
The InChIKey is GWRZBVOUQRBUJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2OS/c9-4-7-12-8(11)10-5-2-1-3-6-10/h1-7,9H2.
What are the key properties of S-(2-aminoethyl) piperidine-1-carbothioate?
S-(2-aminoethyl) piperidine-1-carbothioate has a molecular weight of 188.30 g/mol, XLogP of 1.28, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-(2-aminoethyl) piperidine-1-carbothioate is sourced from PubChem (CID 19851804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).