C13H14O — CID 169444620
3,3,3-trideuterio-2-naphthalen-1-ylpropan-1-ol (PubChem CID 169444620) has the molecular formula C13H14O and a molecular weight of 189.27 g/mol. Its IUPAC name is 3,3,3-trideuterio-2-naphthalen-1-ylpropan-1-ol.
| Compound Name | 3,3,3-trideuterio-2-naphthalen-1-ylpropan-1-ol |
|---|---|
| PubChem CID | 169444620 |
| Molecular Formula | C13H14O |
| Molecular Weight | 189.27 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | 3,3,3-trideuterio-2-naphthalen-1-ylpropan-1-ol |
| SMILES | [2H]C([2H])([2H])C(CO)c1cccc2ccccc12 |
| InChI | InChI=1S/C13H14O/c1-10(9-14)12-8-4-6-11-5-2-3-7-13(11)12/h2-8,10,14H,9H2,1H3/i1D3 |
| InChIKey | YZMWRFOKAISJQX-FIBGUPNXSA-N |
| XLogP | 2.94 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.27 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |