C12H27O4P — CID 169445617
tris[2,3,3,3-tetradeuterio-2-(trideuteriomethyl)propyl] phosphate (PubChem CID 169445617) has the molecular formula C12H27O4P and a molecular weight of 287.45 g/mol. Its IUPAC name is tris[2,3,3,3-tetradeuterio-2-(trideuteriomethyl)propyl] phosphate.
| Compound Name | tris[2,3,3,3-tetradeuterio-2-(trideuteriomethyl)propyl] phosphate |
|---|---|
| PubChem CID | 169445617 |
| Molecular Formula | C12H27O4P |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.30 |
| IUPAC Name | tris[2,3,3,3-tetradeuterio-2-(trideuteriomethyl)propyl] phosphate |
| SMILES | [2H]C([2H])([2H])C([2H])(COP(=O)(OCC([2H])(C([2H])([2H])[2H])C([2H])([2H])[2H])OCC([2H])(C([2H])([2H])[2H])C([2H])([2H])[2H])C([2H])([2H])[2H] |
| InChI | InChI=1S/C12H27O4P/c1-10(2)7-14-17(13,15-8-11(3)4)16-9-12(5)6/h10-12H,7-9H2,1-6H3/i1D3,2D3,3D3,4D3,5D3,6D3,10D,11D,12D |
| InChIKey | HRKAMJBPFPHCSD-BHXXUPBMSA-N |
| XLogP | 4.11 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|