C8H19O4P — CID 169438675
bis[2,3,3,3-tetradeuterio-2-(trideuteriomethyl)propyl] hydrogen phosphate (PubChem CID 169438675) has the molecular formula C8H19O4P and a molecular weight of 224.30 g/mol. Its IUPAC name is bis[2,3,3,3-tetradeuterio-2-(trideuteriomethyl)propyl] hydrogen phosphate.
| Compound Name | bis[2,3,3,3-tetradeuterio-2-(trideuteriomethyl)propyl] hydrogen phosphate |
|---|---|
| PubChem CID | 169438675 |
| Molecular Formula | C8H19O4P |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.19 |
| IUPAC Name | bis[2,3,3,3-tetradeuterio-2-(trideuteriomethyl)propyl] hydrogen phosphate |
| SMILES | [2H]C([2H])([2H])C([2H])(COP(=O)(O)OCC([2H])(C([2H])([2H])[2H])C([2H])([2H])[2H])C([2H])([2H])[2H] |
| InChI | InChI=1S/C8H19O4P/c1-7(2)5-11-13(9,10)12-6-8(3)4/h7-8H,5-6H2,1-4H3,(H,9,10)/i1D3,2D3,3D3,4D3,7D,8D |
| InChIKey | PVQVJLCMPNEFPM-GLHILRGCSA-N |
| XLogP | 2.43 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|